Chemical Component Summary

Name[(1~{S},2~{R},3~{S},4~{S},5~{R},6~{S})-2-(hydroxymethyl)-3,4,5,6-tetrakis(oxidanyl)cyclohexyl] hydrogen sulfate
Identifiers[(1~{S},2~{R},3~{S},4~{S},5~{R},6~{S})-2-(hydroxymethyl)-3,4,5,6-tetrakis(oxidanyl)cyclohexyl] hydrogen sulfate
FormulaC7 H14 O9 S
Molecular Weight274.25
TypeNON-POLYMER
Isomeric SMILESOC[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O[S](O)(=O)=O
InChIInChI=1S/C7H14O9S/c8-1-2-3(9)4(10)5(11)6(12)7(2)16-17(13,14)15/h2-12H,1H2,(H,13,14,15)/t2-,3+,4+,5-,6+,7+/m1/s1
InChIKeyPDBNIRCVRHFXAD-ADTCQYHUSA-N

Chemical Details

Formal Charge0
Atom Count31
Chiral Atom Count6
Bond Count31
Aromatic Bond Count0